C13H22N3O4S+ — CID 170532531
(E)-imino-[(5S)-5-[[(2S)-2-methylsulfanylpropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium (PubChem CID 170532531) has the molecular formula C13H22N3O4S+ and a molecular weight of 316.40 g/mol. Its IUPAC name is (E)-imino-[(5S)-5-[[(2S)-2-methylsulfanylpropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium.
| Compound Name | (E)-imino-[(5S)-5-[[(2S)-2-methylsulfanylpropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium |
|---|---|
| PubChem CID | 170532531 |
| Molecular Formula | C13H22N3O4S+ |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (E)-imino-[(5S)-5-[[(2S)-2-methylsulfanylpropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium |
| SMILES | CS[C@@H](C)C(=O)N[C@@H](CCC(=O)C=[N+]=N)C(=O)OC(C)C |
| InChI | InChI=1S/C13H21N3O4S/c1-8(2)20-13(19)11(6-5-10(17)7-15-14)16-12(18)9(3)21-4/h7-9,11,14H,5-6H2,1-4H3/p+1/t9-,11-/m0/s1 |
| InChIKey | PSNPNMSURHFCEJ-ONGXEEELSA-O |
| XLogP | 0.83 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|