C16H26N3O7+ — CID 145243982
imino-[(5S)-5-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium (PubChem CID 145243982) has the molecular formula C16H26N3O7+ and a molecular weight of 372.40 g/mol. Its IUPAC name is imino-[(5S)-5-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium.
| Compound Name | imino-[(5S)-5-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium |
|---|---|
| PubChem CID | 145243982 |
| Molecular Formula | C16H26N3O7+ |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | imino-[(5S)-5-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium |
| SMILES | CC(C)OC(=O)[C@H](CCC(=O)C=[N+]=N)NC(=O)OC(C)OC(=O)C(C)C |
| InChI | InChI=1S/C16H25N3O7/c1-9(2)14(21)25-11(5)26-16(23)19-13(15(22)24-10(3)4)7-6-12(20)8-18-17/h8-11,13,17H,6-7H2,1-5H3/p+1/t11?,13-/m0/s1 |
| InChIKey | YBDMTMOTPVJVLD-YUZLPWPTSA-O |
| XLogP | 1.24 |
| TPSA | 145.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|