C19H31N3O7 — CID 137033614
propan-2-yl (2S)-6-diazo-2-[[1-(2,2-dimethylpropanoyloxy)-2-methylpropoxy]carbonylamino]-5-oxohexanoate (PubChem CID 137033614) has the molecular formula C19H31N3O7 and a molecular weight of 413.47 g/mol. Its IUPAC name is propan-2-yl (2S)-6-diazo-2-[[1-(2,2-dimethylpropanoyloxy)-2-methylpropoxy]carbonylamino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-diazo-2-[[1-(2,2-dimethylpropanoyloxy)-2-methylpropoxy]carbonylamino]-5-oxohexanoate |
|---|---|
| PubChem CID | 137033614 |
| Molecular Formula | C19H31N3O7 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | propan-2-yl (2S)-6-diazo-2-[[1-(2,2-dimethylpropanoyloxy)-2-methylpropoxy]carbonylamino]-5-oxohexanoate |
| SMILES | CC(C)OC(=O)[C@H](CCC(=O)C=[N+]=[N-])NC(=O)OC(OC(=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C19H31N3O7/c1-11(2)16(28-17(25)19(5,6)7)29-18(26)22-14(15(24)27-12(3)4)9-8-13(23)10-21-20/h10-12,14,16H,8-9H2,1-7H3,(H,22,26)/t14-,16?/m0/s1 |
| InChIKey | YNXOEYCVNAGYFD-LBAUFKAWSA-N |
| XLogP | 2.25 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|