C18H29N2O7+ — CID 158729393
[(5S)-5-[[(1R)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium (PubChem CID 158729393) has the molecular formula C18H29N2O7+ and a molecular weight of 385.44 g/mol. Its IUPAC name is [(5S)-5-[[(1R)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium.
| Compound Name | [(5S)-5-[[(1R)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium |
|---|---|
| PubChem CID | 158729393 |
| Molecular Formula | C18H29N2O7+ |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | [(5S)-5-[[(1R)-1-(2,2-dimethylpropanoyloxy)ethoxy]carbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-methylideneazanium |
| SMILES | C=[N+]=CC(=O)CC[C@H](NC(=O)O[C@H](C)OC(=O)C(C)(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C18H28N2O7/c1-11(2)25-15(22)14(9-8-13(21)10-19-7)20-17(24)27-12(3)26-16(23)18(4,5)6/h10-12,14H,7-9H2,1-6H3/p+1/t12-,14+/m1/s1 |
| InChIKey | CWSZEFPEDZJZAL-OCCSQVGLSA-O |
| XLogP | 1.16 |
| TPSA | 122.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|