C17H27N2O7+ — CID 157460926
methylidene-[(5S)-5-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium (PubChem CID 157460926) has the molecular formula C17H27N2O7+ and a molecular weight of 371.41 g/mol. Its IUPAC name is methylidene-[(5S)-5-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium.
| Compound Name | methylidene-[(5S)-5-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium |
|---|---|
| PubChem CID | 157460926 |
| Molecular Formula | C17H27N2O7+ |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | methylidene-[(5S)-5-[1-(2-methylpropanoyloxy)ethoxycarbonylamino]-2,6-dioxo-6-propan-2-yloxyhexylidene]azanium |
| SMILES | C=[N+]=CC(=O)CC[C@H](NC(=O)OC(C)OC(=O)C(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C17H26N2O7/c1-10(2)15(21)25-12(5)26-17(23)19-14(16(22)24-11(3)4)8-7-13(20)9-18-6/h9-12,14H,6-8H2,1-5H3/p+1/t12?,14-/m0/s1 |
| InChIKey | HTWJGVNIZALEFD-PYMCNQPYSA-O |
| XLogP | 0.77 |
| TPSA | 122.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|