C21H26FN3O5 — CID 167015308
propan-2-yl (2S)-2-[[(2S)-3-(5-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-6-imino-5-oxohexanoate (PubChem CID 167015308) has the molecular formula C21H26FN3O5 and a molecular weight of 419.45 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(2S)-3-(5-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-6-imino-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-2-[[(2S)-3-(5-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-6-imino-5-oxohexanoate |
|---|---|
| PubChem CID | 167015308 |
| Molecular Formula | C21H26FN3O5 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[(2S)-3-(5-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-6-imino-5-oxohexanoate |
| SMILES | [H]/N=C/C(=O)CC[C@H](NC(=O)[C@H](Cc1c[nH]c2ccc(F)cc12)OC)C(=O)OC(C)C |
| InChI | InChI=1S/C21H26FN3O5/c1-12(2)30-21(28)18(7-5-15(26)10-23)25-20(27)19(29-3)8-13-11-24-17-6-4-14(22)9-16(13)17/h4,6,9-12,18-19,23-24H,5,7-8H2,1-3H3,(H,25,27)/b23-10+/t18-,19-/m0/s1 |
| InChIKey | PQFRSGZIXVKCFR-UKEHVSJJSA-N |
| XLogP | 2.30 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|