C21H26FN4O5+ — CID 170532514
(E)-[(5S)-5-[[(2S)-3-(4-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-iminoazanium (PubChem CID 170532514) has the molecular formula C21H26FN4O5+ and a molecular weight of 433.46 g/mol. Its IUPAC name is (E)-[(5S)-5-[[(2S)-3-(4-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-iminoazanium.
| Compound Name | (E)-[(5S)-5-[[(2S)-3-(4-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-iminoazanium |
|---|---|
| PubChem CID | 170532514 |
| Molecular Formula | C21H26FN4O5+ |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (E)-[(5S)-5-[[(2S)-3-(4-fluoro-1H-indol-3-yl)-2-methoxypropanoyl]amino]-2,6-dioxo-6-propan-2-yloxyhexylidene]-iminoazanium |
| SMILES | CO[C@@H](Cc1c[nH]c2cccc(F)c12)C(=O)N[C@@H](CCC(=O)C=[N+]=N)C(=O)OC(C)C |
| InChI | InChI=1S/C21H25FN4O5/c1-12(2)31-21(29)17(8-7-14(27)11-25-23)26-20(28)18(30-3)9-13-10-24-16-6-4-5-15(22)19(13)16/h4-6,10-12,17-18,23-24H,7-9H2,1-3H3/p+1/t17-,18-/m0/s1 |
| InChIKey | YPCMOIODTLDNLX-ROUUACIJSA-O |
| XLogP | 1.96 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|