C22H28N4O5 — CID 170443975
propan-2-yl (2S)-6-diazo-2-[[(2R)-2-methoxy-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohexanoate (PubChem CID 170443975) has the molecular formula C22H28N4O5 and a molecular weight of 428.49 g/mol. Its IUPAC name is propan-2-yl (2S)-6-diazo-2-[[(2R)-2-methoxy-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohexanoate.
| Compound Name | propan-2-yl (2S)-6-diazo-2-[[(2R)-2-methoxy-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohexanoate |
|---|---|
| PubChem CID | 170443975 |
| Molecular Formula | C22H28N4O5 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | propan-2-yl (2S)-6-diazo-2-[[(2R)-2-methoxy-3-(1-methylindol-3-yl)propanoyl]amino]-5-oxohexanoate |
| SMILES | CO[C@H](Cc1cn(C)c2ccccc12)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)OC(C)C |
| InChI | InChI=1S/C22H28N4O5/c1-14(2)31-22(29)18(10-9-16(27)12-24-23)25-21(28)20(30-4)11-15-13-26(3)19-8-6-5-7-17(15)19/h5-8,12-14,18,20H,9-11H2,1-4H3,(H,25,28)/t18-,20+/m0/s1 |
| InChIKey | ZTQQLMFZCSYHLZ-AZUAARDMSA-N |
| XLogP | 1.82 |
| TPSA | 123.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|