C16H26NO4P — CID 123387305
propan-2-yl 2-[[phenoxy(propan-2-yl)phosphoryl]amino]butanoate (PubChem CID 123387305) has the molecular formula C16H26NO4P and a molecular weight of 327.36 g/mol. Its IUPAC name is propan-2-yl 2-[[phenoxy(propan-2-yl)phosphoryl]amino]butanoate.
| Compound Name | propan-2-yl 2-[[phenoxy(propan-2-yl)phosphoryl]amino]butanoate |
|---|---|
| PubChem CID | 123387305 |
| Molecular Formula | C16H26NO4P |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | propan-2-yl 2-[[phenoxy(propan-2-yl)phosphoryl]amino]butanoate |
| SMILES | CCC(NP(=O)(Oc1ccccc1)C(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C16H26NO4P/c1-6-15(16(18)20-12(2)3)17-22(19,13(4)5)21-14-10-8-7-9-11-14/h7-13,15H,6H2,1-5H3,(H,17,19) |
| InChIKey | OTWZASFKPFFVDL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|