C11H16ClNO4P2 — CID 146559026
propan-2-yl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-2-phosphanylacetate (PubChem CID 146559026) has the molecular formula C11H16ClNO4P2 and a molecular weight of 323.65 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-2-phosphanylacetate.
| Compound Name | propan-2-yl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-2-phosphanylacetate |
|---|---|
| PubChem CID | 146559026 |
| Molecular Formula | C11H16ClNO4P2 |
| Molecular Weight | 323.65 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | propan-2-yl (2S)-2-[[chloro(phenoxy)phosphoryl]amino]-2-phosphanylacetate |
| SMILES | CC(C)OC(=O)[C@H](P)NP(=O)(Cl)Oc1ccccc1 |
| InChI | InChI=1S/C11H16ClNO4P2/c1-8(2)16-11(14)10(18)13-19(12,15)17-9-6-4-3-5-7-9/h3-8,10H,18H2,1-2H3,(H,13,15)/t10-,19?/m0/s1 |
| InChIKey | BWMCTRCKJXMDAF-IHBJSSOOSA-N |
| XLogP | 3.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|