C13H19ClNO4P — CID 59185393
[(2S)-2-[[chloro(phenoxy)phosphoryl]amino]propyl] butanoate (PubChem CID 59185393) has the molecular formula C13H19ClNO4P and a molecular weight of 319.72 g/mol. Its IUPAC name is [(2S)-2-[[chloro(phenoxy)phosphoryl]amino]propyl] butanoate.
| Compound Name | [(2S)-2-[[chloro(phenoxy)phosphoryl]amino]propyl] butanoate |
|---|---|
| PubChem CID | 59185393 |
| Molecular Formula | C13H19ClNO4P |
| Molecular Weight | 319.72 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [(2S)-2-[[chloro(phenoxy)phosphoryl]amino]propyl] butanoate |
| SMILES | CCCC(=O)OC[C@H](C)NP(=O)(Cl)Oc1ccccc1 |
| InChI | InChI=1S/C13H19ClNO4P/c1-3-7-13(16)18-10-11(2)15-20(14,17)19-12-8-5-4-6-9-12/h4-6,8-9,11H,3,7,10H2,1-2H3,(H,15,17)/t11-,20?/m0/s1 |
| InChIKey | AIIJAZDBFWOBRD-ZOZMEPSFSA-N |
| XLogP | 3.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|