C13H17ClNO4P — CID 72517256
cyclobutyl 2-[[chloro(phenoxy)phosphoryl]amino]propanoate (PubChem CID 72517256) has the molecular formula C13H17ClNO4P and a molecular weight of 317.71 g/mol. Its IUPAC name is cyclobutyl 2-[[chloro(phenoxy)phosphoryl]amino]propanoate.
| Compound Name | cyclobutyl 2-[[chloro(phenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 72517256 |
| Molecular Formula | C13H17ClNO4P |
| Molecular Weight | 317.71 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | cyclobutyl 2-[[chloro(phenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(NP(=O)(Cl)Oc1ccccc1)C(=O)OC1CCC1 |
| InChI | InChI=1S/C13H17ClNO4P/c1-10(13(16)18-11-8-5-9-11)15-20(14,17)19-12-6-3-2-4-7-12/h2-4,6-7,10-11H,5,8-9H2,1H3,(H,15,17) |
| InChIKey | QNROABKSCZMLRI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|