C19H35N2O5P — CID 123600330
cyclohexyl 2-[[[(1-cyclohexyloxy-1-oxopropan-2-yl)amino]-methylphosphoryl]amino]propanoate (PubChem CID 123600330) has the molecular formula C19H35N2O5P and a molecular weight of 402.47 g/mol. Its IUPAC name is cyclohexyl 2-[[[(1-cyclohexyloxy-1-oxopropan-2-yl)amino]-methylphosphoryl]amino]propanoate.
| Compound Name | cyclohexyl 2-[[[(1-cyclohexyloxy-1-oxopropan-2-yl)amino]-methylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123600330 |
| Molecular Formula | C19H35N2O5P |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | cyclohexyl 2-[[[(1-cyclohexyloxy-1-oxopropan-2-yl)amino]-methylphosphoryl]amino]propanoate |
| SMILES | CC(NP(C)(=O)NC(C)C(=O)OC1CCCCC1)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C19H35N2O5P/c1-14(18(22)25-16-10-6-4-7-11-16)20-27(3,24)21-15(2)19(23)26-17-12-8-5-9-13-17/h14-17H,4-13H2,1-3H3,(H2,20,21,24) |
| InChIKey | WHNIOLFIEYIEHG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|