C19H30NO4P — CID 59853405
cycloheptyl (2S)-2-[[phenoxy(propan-2-yl)phosphoryl]amino]propanoate (PubChem CID 59853405) has the molecular formula C19H30NO4P and a molecular weight of 367.43 g/mol. Its IUPAC name is cycloheptyl (2S)-2-[[phenoxy(propan-2-yl)phosphoryl]amino]propanoate.
| Compound Name | cycloheptyl (2S)-2-[[phenoxy(propan-2-yl)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 59853405 |
| Molecular Formula | C19H30NO4P |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | cycloheptyl (2S)-2-[[phenoxy(propan-2-yl)phosphoryl]amino]propanoate |
| SMILES | CC(C)P(=O)(N[C@@H](C)C(=O)OC1CCCCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C19H30NO4P/c1-15(2)25(22,24-18-13-9-6-10-14-18)20-16(3)19(21)23-17-11-7-4-5-8-12-17/h6,9-10,13-17H,4-5,7-8,11-12H2,1-3H3,(H,20,22)/t16-,25?/m0/s1 |
| InChIKey | ALFLXXTUKKAXLW-YPHZTSLFSA-N |
| XLogP | 4.91 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|