C29H22F6NO6PS — CID 178108613
(2,3,4,5,6-pentafluorophenyl) 5-[[[(1-cyclobutyloxy-1-oxopropan-2-yl)amino]-phenoxyphosphoryl]-fluoromethyl]-1-benzothiophene-2-carboxylate (PubChem CID 178108613) has the molecular formula C29H22F6NO6PS and a molecular weight of 657.53 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-[[[(1-cyclobutyloxy-1-oxopropan-2-yl)amino]-phenoxyphosphoryl]-fluoromethyl]-1-benzothiophene-2-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-[[[(1-cyclobutyloxy-1-oxopropan-2-yl)amino]-phenoxyphosphoryl]-fluoromethyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 178108613 |
| Molecular Formula | C29H22F6NO6PS |
| Molecular Weight | 657.53 g/mol |
| Exact Mass | 657.08 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-[[[(1-cyclobutyloxy-1-oxopropan-2-yl)amino]-phenoxyphosphoryl]-fluoromethyl]-1-benzothiophene-2-carboxylate |
| SMILES | CC(NP(=O)(Oc1ccccc1)C(F)c1ccc2sc(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)cc2c1)C(=O)OC1CCC1 |
| InChI | InChI=1S/C29H22F6NO6PS/c1-14(28(37)40-17-8-5-9-17)36-43(39,42-18-6-3-2-4-7-18)27(35)15-10-11-19-16(12-15)13-20(44-19)29(38)41-26-24(33)22(31)21(30)23(32)25(26)34/h2-4,6-7,10-14,17,27H,5,8-9H2,1H3,(H,36,39) |
| InChIKey | NNIMDUPOVWKNFW-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.53 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|