C25H24F4NO6PS — CID 168981709
prop-2-enyl 5-[fluoro-[[[(2S)-1-oxo-1-(3,3,3-trifluoropropoxy)propan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate (PubChem CID 168981709) has the molecular formula C25H24F4NO6PS and a molecular weight of 573.50 g/mol. Its IUPAC name is prop-2-enyl 5-[fluoro-[[[(2S)-1-oxo-1-(3,3,3-trifluoropropoxy)propan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | prop-2-enyl 5-[fluoro-[[[(2S)-1-oxo-1-(3,3,3-trifluoropropoxy)propan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 168981709 |
| Molecular Formula | C25H24F4NO6PS |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 573.10 |
| IUPAC Name | prop-2-enyl 5-[fluoro-[[[(2S)-1-oxo-1-(3,3,3-trifluoropropoxy)propan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate |
| SMILES | C=CCOC(=O)c1cc2cc(C(F)P(=O)(N[C@@H](C)C(=O)OCCC(F)(F)F)Oc3ccccc3)ccc2s1 |
| InChI | InChI=1S/C25H24F4NO6PS/c1-3-12-34-24(32)21-15-18-14-17(9-10-20(18)38-21)22(26)37(33,36-19-7-5-4-6-8-19)30-16(2)23(31)35-13-11-25(27,28)29/h3-10,14-16,22H,1,11-13H2,2H3,(H,30,33)/t16-,22?,37?/m0/s1 |
| InChIKey | QXMMPOPFWONQJG-FSTHLEAXSA-N |
| XLogP | 6.96 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|