C23H25FNO5PS — CID 168980589
propyl 2-[[[1-fluoro-1-(2-formyl-1-benzothiophen-5-yl)ethyl]-phenoxyphosphoryl]amino]propanoate (PubChem CID 168980589) has the molecular formula C23H25FNO5PS and a molecular weight of 477.49 g/mol. Its IUPAC name is propyl 2-[[[1-fluoro-1-(2-formyl-1-benzothiophen-5-yl)ethyl]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propyl 2-[[[1-fluoro-1-(2-formyl-1-benzothiophen-5-yl)ethyl]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 168980589 |
| Molecular Formula | C23H25FNO5PS |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | propyl 2-[[[1-fluoro-1-(2-formyl-1-benzothiophen-5-yl)ethyl]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCOC(=O)C(C)NP(=O)(Oc1ccccc1)C(C)(F)c1ccc2sc(C=O)cc2c1 |
| InChI | InChI=1S/C23H25FNO5PS/c1-4-12-29-22(27)16(2)25-31(28,30-19-8-6-5-7-9-19)23(3,24)18-10-11-21-17(13-18)14-20(15-26)32-21/h5-11,13-16H,4,12H2,1-3H3,(H,25,28) |
| InChIKey | BYUXOHJCQSPNJN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|