C18H21F3NO5PS — CID 178108534
propyl 2-[[(2-formyl-1-benzothiophen-5-yl)methyl-(2,2,2-trifluoroethoxy)phosphoryl]amino]propanoate (PubChem CID 178108534) has the molecular formula C18H21F3NO5PS and a molecular weight of 451.40 g/mol. Its IUPAC name is propyl 2-[[(2-formyl-1-benzothiophen-5-yl)methyl-(2,2,2-trifluoroethoxy)phosphoryl]amino]propanoate.
| Compound Name | propyl 2-[[(2-formyl-1-benzothiophen-5-yl)methyl-(2,2,2-trifluoroethoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 178108534 |
| Molecular Formula | C18H21F3NO5PS |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | propyl 2-[[(2-formyl-1-benzothiophen-5-yl)methyl-(2,2,2-trifluoroethoxy)phosphoryl]amino]propanoate |
| SMILES | CCCOC(=O)C(C)NP(=O)(Cc1ccc2sc(C=O)cc2c1)OCC(F)(F)F |
| InChI | InChI=1S/C18H21F3NO5PS/c1-3-6-26-17(24)12(2)22-28(25,27-11-18(19,20)21)10-13-4-5-16-14(7-13)8-15(9-23)29-16/h4-5,7-9,12H,3,6,10-11H2,1-2H3,(H,22,25) |
| InChIKey | KWVKYJONKVFBCG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|