C22H24NO4PS — CID 168980795
propyl 2-[[(2-formyl-1-benzothiophen-5-yl)methyl-phenoxyphosphanyl]amino]propanoate (PubChem CID 168980795) has the molecular formula C22H24NO4PS and a molecular weight of 429.48 g/mol. Its IUPAC name is propyl 2-[[(2-formyl-1-benzothiophen-5-yl)methyl-phenoxyphosphanyl]amino]propanoate.
| Compound Name | propyl 2-[[(2-formyl-1-benzothiophen-5-yl)methyl-phenoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 168980795 |
| Molecular Formula | C22H24NO4PS |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | propyl 2-[[(2-formyl-1-benzothiophen-5-yl)methyl-phenoxyphosphanyl]amino]propanoate |
| SMILES | CCCOC(=O)C(C)NP(Cc1ccc2sc(C=O)cc2c1)Oc1ccccc1 |
| InChI | InChI=1S/C22H24NO4PS/c1-3-11-26-22(25)16(2)23-28(27-19-7-5-4-6-8-19)15-17-9-10-21-18(12-17)13-20(14-24)29-21/h4-10,12-14,16,23H,3,11,15H2,1-2H3 |
| InChIKey | FYRAVRRCIUXZQC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|