C29H27F7NO5PS — CID 178108689
difluoromethane;(2,3,4,5,6-pentafluorophenyl) 5-(phenoxyphosphanylmethyl)-1-benzothiophene-2-carboxylate;propyl 2-aminopropanoate (PubChem CID 178108689) has the molecular formula C29H27F7NO5PS and a molecular weight of 665.56 g/mol. Its IUPAC name is difluoromethane;(2,3,4,5,6-pentafluorophenyl) 5-(phenoxyphosphanylmethyl)-1-benzothiophene-2-carboxylate;propyl 2-aminopropanoate.
| Compound Name | difluoromethane;(2,3,4,5,6-pentafluorophenyl) 5-(phenoxyphosphanylmethyl)-1-benzothiophene-2-carboxylate;propyl 2-aminopropanoate |
|---|---|
| PubChem CID | 178108689 |
| Molecular Formula | C29H27F7NO5PS |
| Molecular Weight | 665.56 g/mol |
| Exact Mass | 665.12 |
| IUPAC Name | difluoromethane;(2,3,4,5,6-pentafluorophenyl) 5-(phenoxyphosphanylmethyl)-1-benzothiophene-2-carboxylate;propyl 2-aminopropanoate |
| SMILES | CCCOC(=O)C(C)N.FCF.O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1cc2cc(CPOc3ccccc3)ccc2s1 |
| InChI | InChI=1S/C22H12F5O3PS.C6H13NO2.CH2F2/c23-16-17(24)19(26)21(20(27)18(16)25)29-22(28)15-9-12-8-11(6-7-14(12)32-15)10-31-30-13-4-2-1-3-5-13;1-3-4-9-6(8)5(2)7;2-1-3/h1-9,31H,10H2;5H,3-4,7H2,1-2H3;1H2 |
| InChIKey | ZZPCGTYBWXDOLR-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.56 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|