C22H23N2O4PS — CID 169219280
propyl 2-[3-(2-carbamoyl-1-benzothiophen-5-yl)-2-phenoxyazaphosphiridin-1-yl]propanoate (PubChem CID 169219280) has the molecular formula C22H23N2O4PS and a molecular weight of 442.48 g/mol. Its IUPAC name is propyl 2-[3-(2-carbamoyl-1-benzothiophen-5-yl)-2-phenoxyazaphosphiridin-1-yl]propanoate.
| Compound Name | propyl 2-[3-(2-carbamoyl-1-benzothiophen-5-yl)-2-phenoxyazaphosphiridin-1-yl]propanoate |
|---|---|
| PubChem CID | 169219280 |
| Molecular Formula | C22H23N2O4PS |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | propyl 2-[3-(2-carbamoyl-1-benzothiophen-5-yl)-2-phenoxyazaphosphiridin-1-yl]propanoate |
| SMILES | CCCOC(=O)C(C)N1C(c2ccc3sc(C(N)=O)cc3c2)P1Oc1ccccc1 |
| InChI | InChI=1S/C22H23N2O4PS/c1-3-11-27-22(26)14(2)24-21(29(24)28-17-7-5-4-6-8-17)15-9-10-18-16(12-15)13-19(30-18)20(23)25/h4-10,12-14,21H,3,11H2,1-2H3,(H2,23,25) |
| InChIKey | ZUXWSMPBWDWCEU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|