C28H22F6NO6PS — CID 176805420
(2,3,4,5,6-pentafluorophenyl) 5-[(R)-fluoro-[[[(2S)-1-oxo-1-propoxypropan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate (PubChem CID 176805420) has the molecular formula C28H22F6NO6PS and a molecular weight of 645.51 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-[(R)-fluoro-[[[(2S)-1-oxo-1-propoxypropan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-[(R)-fluoro-[[[(2S)-1-oxo-1-propoxypropan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 176805420 |
| Molecular Formula | C28H22F6NO6PS |
| Molecular Weight | 645.51 g/mol |
| Exact Mass | 645.08 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-[(R)-fluoro-[[[(2S)-1-oxo-1-propoxypropan-2-yl]amino]-phenoxyphosphoryl]methyl]-1-benzothiophene-2-carboxylate |
| SMILES | CCCOC(=O)[C@H](C)N[P@@](=O)(Oc1ccccc1)[C@@H](F)c1ccc2sc(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)cc2c1 |
| InChI | InChI=1S/C28H22F6NO6PS/c1-3-11-39-27(36)14(2)35-42(38,41-17-7-5-4-6-8-17)26(34)15-9-10-18-16(12-15)13-19(43-18)28(37)40-25-23(32)21(30)20(29)22(31)24(25)33/h4-10,12-14,26H,3,11H2,1-2H3,(H,35,38)/t14-,26+,42-/m0/s1 |
| InChIKey | PCRUUJZBGMPVBT-IGZMBANGSA-N |
| XLogP | 7.99 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.51 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|