C21H18F5O5PS — CID 178108729
[(R)-fluoro-[2-[2,3,5,6-tetrafluoro-4-[(2S)-2-methylbutyl]phenoxy]carbonyl-1-benzothiophen-5-yl]methyl]phosphonic acid (PubChem CID 178108729) has the molecular formula C21H18F5O5PS and a molecular weight of 508.40 g/mol. Its IUPAC name is [(R)-fluoro-[2-[2,3,5,6-tetrafluoro-4-[(2S)-2-methylbutyl]phenoxy]carbonyl-1-benzothiophen-5-yl]methyl]phosphonic acid.
| Compound Name | [(R)-fluoro-[2-[2,3,5,6-tetrafluoro-4-[(2S)-2-methylbutyl]phenoxy]carbonyl-1-benzothiophen-5-yl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 178108729 |
| Molecular Formula | C21H18F5O5PS |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | [(R)-fluoro-[2-[2,3,5,6-tetrafluoro-4-[(2S)-2-methylbutyl]phenoxy]carbonyl-1-benzothiophen-5-yl]methyl]phosphonic acid |
| SMILES | CC[C@H](C)Cc1c(F)c(F)c(OC(=O)c2cc3cc([C@H](F)P(=O)(O)O)ccc3s2)c(F)c1F |
| InChI | InChI=1S/C21H18F5O5PS/c1-3-9(2)6-12-15(22)17(24)19(18(25)16(12)23)31-21(27)14-8-11-7-10(4-5-13(11)33-14)20(26)32(28,29)30/h4-5,7-9,20H,3,6H2,1-2H3,(H2,28,29,30)/t9-,20+/m0/s1 |
| InChIKey | OMURZAXLGATIFB-GWNMQOMSSA-N |
| XLogP | 6.41 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|