C13H10Cl2FO3PS — CID 168981246
prop-2-enyl 5-[(R)-dichlorophosphoryl(fluoro)methyl]-1-benzothiophene-2-carboxylate (PubChem CID 168981246) has the molecular formula C13H10Cl2FO3PS and a molecular weight of 367.17 g/mol. Its IUPAC name is prop-2-enyl 5-[(R)-dichlorophosphoryl(fluoro)methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | prop-2-enyl 5-[(R)-dichlorophosphoryl(fluoro)methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 168981246 |
| Molecular Formula | C13H10Cl2FO3PS |
| Molecular Weight | 367.17 g/mol |
| Exact Mass | 365.94 |
| IUPAC Name | prop-2-enyl 5-[(R)-dichlorophosphoryl(fluoro)methyl]-1-benzothiophene-2-carboxylate |
| SMILES | C=CCOC(=O)c1cc2cc([C@H](F)P(=O)(Cl)Cl)ccc2s1 |
| InChI | InChI=1S/C13H10Cl2FO3PS/c1-2-5-19-13(17)11-7-9-6-8(3-4-10(9)21-11)12(16)20(14,15)18/h2-4,6-7,12H,1,5H2/t12-/m1/s1 |
| InChIKey | ZXZLSKATSPJNLD-GFCCVEGCSA-N |
| XLogP | 5.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.17 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|