C25H35N2O6PS — CID 168980580
prop-2-enyl 5-[bis[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphanylmethyl]-1-benzothiophene-2-carboxylate (PubChem CID 168980580) has the molecular formula C25H35N2O6PS and a molecular weight of 522.60 g/mol. Its IUPAC name is prop-2-enyl 5-[bis[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphanylmethyl]-1-benzothiophene-2-carboxylate.
| Compound Name | prop-2-enyl 5-[bis[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphanylmethyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 168980580 |
| Molecular Formula | C25H35N2O6PS |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | prop-2-enyl 5-[bis[(1-oxo-1-propan-2-yloxypropan-2-yl)amino]phosphanylmethyl]-1-benzothiophene-2-carboxylate |
| SMILES | C=CCOC(=O)c1cc2cc(CP(NC(C)C(=O)OC(C)C)NC(C)C(=O)OC(C)C)ccc2s1 |
| InChI | InChI=1S/C25H35N2O6PS/c1-8-11-31-25(30)22-13-20-12-19(9-10-21(20)35-22)14-34(26-17(6)23(28)32-15(2)3)27-18(7)24(29)33-16(4)5/h8-10,12-13,15-18,26-27H,1,11,14H2,2-7H3 |
| InChIKey | CCIKILUGOBIBBC-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|