About 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate
2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate (PubChem CID 62105155) has the molecular formula C14H17NO2S
and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate |
| PubChem CID | 62105155 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate |
| SMILES | CCC(C)COC(=O)c1cc2cc(N)ccc2s1 |
| InChI | InChI=1S/C14H17NO2S/c1-3-9(2)8-17-14(16)13-7-10-6-11(15)4-5-12(10)18-13/h4-7,9H,3,8,15H2,1-2H3 |
| InChIKey | ARTCBMPGPMOZEI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate?
The IUPAC name of 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate (CID 62105155) is 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate.
What is the SMILES notation for 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate?
The canonical SMILES for 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate is CCC(C)COC(=O)c1cc2cc(N)ccc2s1.
What is the InChIKey of 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate?
The InChIKey is ARTCBMPGPMOZEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO2S/c1-3-9(2)8-17-14(16)13-7-10-6-11(15)4-5-12(10)18-13/h4-7,9H,3,8,15H2,1-2H3.
What are the key properties of 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate?
2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate has a molecular weight of 263.36 g/mol, XLogP of 3.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutyl 5-amino-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 62105155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).