C14H16N2O3S — CID 61321395
[2-oxo-2-(propylamino)ethyl] 5-amino-1-benzothiophene-2-carboxylate (PubChem CID 61321395) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is [2-oxo-2-(propylamino)ethyl] 5-amino-1-benzothiophene-2-carboxylate.
| Compound Name | [2-oxo-2-(propylamino)ethyl] 5-amino-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 61321395 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [2-oxo-2-(propylamino)ethyl] 5-amino-1-benzothiophene-2-carboxylate |
| SMILES | CCCNC(=O)COC(=O)c1cc2cc(N)ccc2s1 |
| InChI | InChI=1S/C14H16N2O3S/c1-2-5-16-13(17)8-19-14(18)12-7-9-6-10(15)3-4-11(9)20-12/h3-4,6-7H,2,5,8,15H2,1H3,(H,16,17) |
| InChIKey | ZCWWFTCNZXKWPX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|