C15H17NO3S — CID 8508158
[2-(butylamino)-2-oxoethyl] 1-benzothiophene-2-carboxylate (PubChem CID 8508158) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 1-benzothiophene-2-carboxylate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 8508158 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 1-benzothiophene-2-carboxylate |
| SMILES | CCCCNC(=O)COC(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C15H17NO3S/c1-2-3-8-16-14(17)10-19-15(18)13-9-11-6-4-5-7-12(11)20-13/h4-7,9H,2-3,8,10H2,1H3,(H,16,17) |
| InChIKey | DSVZMWBBQAPIJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|