About (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate
(3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate (PubChem CID 63450666) has the molecular formula C16H12BrNO2S
and a molecular weight of 362.25 g/mol. Its IUPAC name is (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate.
Molecular Properties
| Compound Name | (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate |
| PubChem CID | 63450666 |
| Molecular Formula | C16H12BrNO2S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate |
| SMILES | Nc1ccc2sc(C(=O)OCc3cccc(Br)c3)cc2c1 |
| InChI | InChI=1S/C16H12BrNO2S/c17-12-3-1-2-10(6-12)9-20-16(19)15-8-11-7-13(18)4-5-14(11)21-15/h1-8H,9,18H2 |
| InChIKey | BLYRNOSQPPTOOD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate?
The IUPAC name of (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate (CID 63450666) is (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate.
What is the SMILES notation for (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate?
The canonical SMILES for (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate is Nc1ccc2sc(C(=O)OCc3cccc(Br)c3)cc2c1.
What is the InChIKey of (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate?
The InChIKey is BLYRNOSQPPTOOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrNO2S/c17-12-3-1-2-10(6-12)9-20-16(19)15-8-11-7-13(18)4-5-14(11)21-15/h1-8H,9,18H2.
What are the key properties of (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate?
(3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate has a molecular weight of 362.25 g/mol, XLogP of 4.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)methyl 5-amino-1-benzothiophene-2-carboxylate is sourced from PubChem (CID 63450666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).