C12H10F3NO3S — CID 106705738
2,2,2-trifluoroethoxymethyl 5-amino-1-benzothiophene-2-carboxylate (PubChem CID 106705738) has the molecular formula C12H10F3NO3S and a molecular weight of 305.28 g/mol. Its IUPAC name is 2,2,2-trifluoroethoxymethyl 5-amino-1-benzothiophene-2-carboxylate.
| Compound Name | 2,2,2-trifluoroethoxymethyl 5-amino-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 106705738 |
| Molecular Formula | C12H10F3NO3S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2,2,2-trifluoroethoxymethyl 5-amino-1-benzothiophene-2-carboxylate |
| SMILES | Nc1ccc2sc(C(=O)OCOCC(F)(F)F)cc2c1 |
| InChI | InChI=1S/C12H10F3NO3S/c13-12(14,15)5-18-6-19-11(17)10-4-7-3-8(16)1-2-9(7)20-10/h1-4H,5-6,16H2 |
| InChIKey | RFWLNINRKHEQLQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|