C17H20FO5PS — CID 168982340
prop-2-enyl 5-[(R)-diethoxyphosphoryl(fluoro)methyl]-1-benzothiophene-2-carboxylate (PubChem CID 168982340) has the molecular formula C17H20FO5PS and a molecular weight of 386.38 g/mol. Its IUPAC name is prop-2-enyl 5-[(R)-diethoxyphosphoryl(fluoro)methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | prop-2-enyl 5-[(R)-diethoxyphosphoryl(fluoro)methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 168982340 |
| Molecular Formula | C17H20FO5PS |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | prop-2-enyl 5-[(R)-diethoxyphosphoryl(fluoro)methyl]-1-benzothiophene-2-carboxylate |
| SMILES | C=CCOC(=O)c1cc2cc([C@H](F)P(=O)(OCC)OCC)ccc2s1 |
| InChI | InChI=1S/C17H20FO5PS/c1-4-9-21-17(19)15-11-13-10-12(7-8-14(13)25-15)16(18)24(20,22-5-2)23-6-3/h4,7-8,10-11,16H,1,5-6,9H2,2-3H3/t16-/m1/s1 |
| InChIKey | MEDUSDLHLLNWCI-MRXNPFEDSA-N |
| XLogP | 5.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|