C20H26FO5P — CID 169170830
tert-butyl 7-[diethoxyphosphoryl(fluoro)methyl]naphthalene-2-carboxylate (PubChem CID 169170830) has the molecular formula C20H26FO5P and a molecular weight of 396.40 g/mol. Its IUPAC name is tert-butyl 7-[diethoxyphosphoryl(fluoro)methyl]naphthalene-2-carboxylate.
| Compound Name | tert-butyl 7-[diethoxyphosphoryl(fluoro)methyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 169170830 |
| Molecular Formula | C20H26FO5P |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | tert-butyl 7-[diethoxyphosphoryl(fluoro)methyl]naphthalene-2-carboxylate |
| SMILES | CCOP(=O)(OCC)C(F)c1ccc2ccc(C(=O)OC(C)(C)C)cc2c1 |
| InChI | InChI=1S/C20H26FO5P/c1-6-24-27(23,25-7-2)18(21)15-10-8-14-9-11-16(13-17(14)12-15)19(22)26-20(3,4)5/h8-13,18H,6-7H2,1-5H3 |
| InChIKey | RUSDEXDPHOACSS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|