2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate

C20H26O2 — CID 170192932

IUPAC2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate
SMILESCCC(C)c1ccc2cc(C(=O)OC(C)(C)CC)ccc2c1
InChIInChI=1S/C20H26O2/c1-6-14(3)15-8-9-17-13-18(11-10-16(17)12-15)19(21)22-20(4,5)7-2/h8-14H,6-7H2,1-5H3
InChIKeyZCZDDKJMKUKYCM-UHFFFAOYSA-N
MW298.43 g/mol
LogP5.70
Rot. Bonds5

About 2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate

2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate (PubChem CID 170192932) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate.

Molecular Properties

Compound Name2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate
PubChem CID170192932
Molecular FormulaC20H26O2
Molecular Weight298.43 g/mol
Exact Mass298.19
IUPAC Name2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate
SMILESCCC(C)c1ccc2cc(C(=O)OC(C)(C)CC)ccc2c1
InChIInChI=1S/C20H26O2/c1-6-14(3)15-8-9-17-13-18(11-10-16(17)12-15)19(21)22-20(4,5)7-2/h8-14H,6-7H2,1-5H3
InChIKeyZCZDDKJMKUKYCM-UHFFFAOYSA-N
XLogP5.70
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500298.43
LogP ≤ 55.70
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate?
The IUPAC name of 2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate (CID 170192932) is 2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate.
What is the SMILES notation for 2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate?
The canonical SMILES for 2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate is CCC(C)c1ccc2cc(C(=O)OC(C)(C)CC)ccc2c1.
What is the InChIKey of 2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate?
The InChIKey is ZCZDDKJMKUKYCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O2/c1-6-14(3)15-8-9-17-13-18(11-10-16(17)12-15)19(21)22-20(4,5)7-2/h8-14H,6-7H2,1-5H3.
What are the key properties of 2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate?
2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate has a molecular weight of 298.43 g/mol, XLogP of 5.70, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 6-butan-2-ylnaphthalene-2-carboxylate is sourced from PubChem (CID 170192932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).