C14H16O2 — CID 134463629
6-butan-2-ylnaphthalene-2,3-diol (PubChem CID 134463629) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 6-butan-2-ylnaphthalene-2,3-diol.
| Compound Name | 6-butan-2-ylnaphthalene-2,3-diol |
|---|---|
| PubChem CID | 134463629 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 6-butan-2-ylnaphthalene-2,3-diol |
| SMILES | CCC(C)c1ccc2cc(O)c(O)cc2c1 |
| InChI | InChI=1S/C14H16O2/c1-3-9(2)10-4-5-11-7-13(15)14(16)8-12(11)6-10/h4-9,15-16H,3H2,1-2H3 |
| InChIKey | MJQCBGCKQJZXSS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|