C35H46O2 — CID 161227870
butan-2-ylbenzene;6-butan-2-ylnaphthalen-2-ol;(4-butan-2-ylphenyl)methanol (PubChem CID 161227870) has the molecular formula C35H46O2 and a molecular weight of 498.75 g/mol. Its IUPAC name is butan-2-ylbenzene;6-butan-2-ylnaphthalen-2-ol;(4-butan-2-ylphenyl)methanol.
| Compound Name | butan-2-ylbenzene;6-butan-2-ylnaphthalen-2-ol;(4-butan-2-ylphenyl)methanol |
|---|---|
| PubChem CID | 161227870 |
| Molecular Formula | C35H46O2 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | butan-2-ylbenzene;6-butan-2-ylnaphthalen-2-ol;(4-butan-2-ylphenyl)methanol |
| SMILES | CCC(C)c1ccc(CO)cc1.CCC(C)c1ccc2cc(O)ccc2c1.CCC(C)c1ccccc1 |
| InChI | InChI=1S/C14H16O.C11H16O.C10H14/c1-3-10(2)11-4-5-13-9-14(15)7-6-12(13)8-11;1-3-9(2)11-6-4-10(8-12)5-7-11;1-3-9(2)10-7-5-4-6-8-10/h4-10,15H,3H2,1-2H3;4-7,9,12H,3,8H2,1-2H3;4-9H,3H2,1-2H3 |
| InChIKey | UYJBNJKEWNHERN-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |