C45H56O4 — CID 91072802
6-butan-2-ylnaphthalen-2-ol;4-butan-2-ylphenol;1-[1-(4-butan-2-ylphenoxy)ethoxy]-2,3-dihydro-1H-indene (PubChem CID 91072802) has the molecular formula C45H56O4 and a molecular weight of 660.94 g/mol. Its IUPAC name is 6-butan-2-ylnaphthalen-2-ol;4-butan-2-ylphenol;1-[1-(4-butan-2-ylphenoxy)ethoxy]-2,3-dihydro-1H-indene.
| Compound Name | 6-butan-2-ylnaphthalen-2-ol;4-butan-2-ylphenol;1-[1-(4-butan-2-ylphenoxy)ethoxy]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 91072802 |
| Molecular Formula | C45H56O4 |
| Molecular Weight | 660.94 g/mol |
| Exact Mass | 660.42 |
| IUPAC Name | 6-butan-2-ylnaphthalen-2-ol;4-butan-2-ylphenol;1-[1-(4-butan-2-ylphenoxy)ethoxy]-2,3-dihydro-1H-indene |
| SMILES | CCC(C)c1ccc(O)cc1.CCC(C)c1ccc(OC(C)OC2CCc3ccccc32)cc1.CCC(C)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C21H26O2.C14H16O.C10H14O/c1-4-15(2)17-9-12-19(13-10-17)22-16(3)23-21-14-11-18-7-5-6-8-20(18)21;1-3-10(2)11-4-5-13-9-14(15)7-6-12(13)8-11;1-3-8(2)9-4-6-10(11)7-5-9/h5-10,12-13,15-16,21H,4,11,14H2,1-3H3;4-10,15H,3H2,1-2H3;4-8,11H,3H2,1-2H3 |
| InChIKey | PCWMUCZFRUTDTN-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.94 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|