About 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene
4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene (PubChem CID 118423862) has the molecular formula C24H32O3
and a molecular weight of 368.52 g/mol. Its IUPAC name is 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene |
| PubChem CID | 118423862 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene |
| SMILES | CCC(C)c1ccc(OC(OC2CCOc3ccccc32)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H32O3/c1-6-17(2)18-11-13-19(14-12-18)26-23(24(3,4)5)27-22-15-16-25-21-10-8-7-9-20(21)22/h7-14,17,22-23H,6,15-16H2,1-5H3 |
| InChIKey | GCGPZXSFDMEBQL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene?
The IUPAC name of 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene (CID 118423862) is 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene.
What is the SMILES notation for 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene?
The canonical SMILES for 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene is CCC(C)c1ccc(OC(OC2CCOc3ccccc32)C(C)(C)C)cc1.
What is the InChIKey of 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene?
The InChIKey is GCGPZXSFDMEBQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32O3/c1-6-17(2)18-11-13-19(14-12-18)26-23(24(3,4)5)27-22-15-16-25-21-10-8-7-9-20(21)22/h7-14,17,22-23H,6,15-16H2,1-5H3.
What are the key properties of 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene?
4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene has a molecular weight of 368.52 g/mol, XLogP of 6.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene is sourced from PubChem (CID 118423862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).