C24H32O3 — CID 118423862
4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene (PubChem CID 118423862) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene.
| Compound Name | 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 118423862 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 4-[1-(4-butan-2-ylphenoxy)-2,2-dimethylpropoxy]-3,4-dihydro-2H-chromene |
| SMILES | CCC(C)c1ccc(OC(OC2CCOc3ccccc32)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H32O3/c1-6-17(2)18-11-13-19(14-12-18)26-23(24(3,4)5)27-22-15-16-25-21-10-8-7-9-20(21)22/h7-14,17,22-23H,6,15-16H2,1-5H3 |
| InChIKey | GCGPZXSFDMEBQL-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|