C18H21NO2 — CID 81367470
N-[(1R)-1-(4-methoxyphenyl)ethyl]-3,4-dihydro-2H-chromen-4-amine (PubChem CID 81367470) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is N-[(1R)-1-(4-methoxyphenyl)ethyl]-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | N-[(1R)-1-(4-methoxyphenyl)ethyl]-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 81367470 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N-[(1R)-1-(4-methoxyphenyl)ethyl]-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COc1ccc([C@@H](C)NC2CCOc3ccccc32)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-13(14-7-9-15(20-2)10-8-14)19-17-11-12-21-18-6-4-3-5-16(17)18/h3-10,13,17,19H,11-12H2,1-2H3/t13-,17?/m1/s1 |
| InChIKey | VORINTKLCATZIC-FWJOYPJLSA-N |
| XLogP | 3.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |