C14H17N3O — CID 54881846
N-[1-(1H-pyrazol-5-yl)ethyl]-3,4-dihydro-2H-chromen-4-amine (PubChem CID 54881846) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is N-[1-(1H-pyrazol-5-yl)ethyl]-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | N-[1-(1H-pyrazol-5-yl)ethyl]-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 54881846 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | N-[1-(1H-pyrazol-5-yl)ethyl]-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CC(NC1CCOc2ccccc21)c1ccn[nH]1 |
| InChI | InChI=1S/C14H17N3O/c1-10(12-6-8-15-17-12)16-13-7-9-18-14-5-3-2-4-11(13)14/h2-6,8,10,13,16H,7,9H2,1H3,(H,15,17) |
| InChIKey | CBIXINFGSWHDQU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |