C12H17NO2 — CID 91322782
N-propan-2-yloxy-3,4-dihydro-2H-chromen-4-amine (PubChem CID 91322782) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-propan-2-yloxy-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | N-propan-2-yloxy-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 91322782 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-propan-2-yloxy-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CC(C)ONC1CCOc2ccccc21 |
| InChI | InChI=1S/C12H17NO2/c1-9(2)15-13-11-7-8-14-12-6-4-3-5-10(11)12/h3-6,9,11,13H,7-8H2,1-2H3 |
| InChIKey | GYLPTWLKHIEBMM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|