2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid

C15H20O3 — CID 113451184

IUPAC2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid
SMILESCC(C)C(CC1CCOc2ccccc21)C(=O)O
InChIInChI=1S/C15H20O3/c1-10(2)13(15(16)17)9-11-7-8-18-14-6-4-3-5-12(11)14/h3-6,10-11,13H,7-9H2,1-2H3,(H,16,17)
InChIKeyNDFLHRULBZOFPN-UHFFFAOYSA-N
MW248.32 g/mol
LogP3.30
Rot. Bonds4

About 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid

2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid (PubChem CID 113451184) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid.

Molecular Properties

Compound Name2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid
PubChem CID113451184
Molecular FormulaC15H20O3
Molecular Weight248.32 g/mol
Exact Mass248.14
IUPAC Name2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid
SMILESCC(C)C(CC1CCOc2ccccc21)C(=O)O
InChIInChI=1S/C15H20O3/c1-10(2)13(15(16)17)9-11-7-8-18-14-6-4-3-5-12(11)14/h3-6,10-11,13H,7-9H2,1-2H3,(H,16,17)
InChIKeyNDFLHRULBZOFPN-UHFFFAOYSA-N
XLogP3.30
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.32
LogP ≤ 53.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid?
The IUPAC name of 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid (CID 113451184) is 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid.
What is the SMILES notation for 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid?
The canonical SMILES for 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid is CC(C)C(CC1CCOc2ccccc21)C(=O)O.
What is the InChIKey of 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid?
The InChIKey is NDFLHRULBZOFPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-10(2)13(15(16)17)9-11-7-8-18-14-6-4-3-5-12(11)14/h3-6,10-11,13H,7-9H2,1-2H3,(H,16,17).
What are the key properties of 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid?
2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid has a molecular weight of 248.32 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-chromen-4-ylmethyl)-3-methylbutanoic acid is sourced from PubChem (CID 113451184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).