C13H18O3 — CID 103452745
1-(3,4-dihydro-2H-chromen-4-yl)butane-2,3-diol (PubChem CID 103452745) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)butane-2,3-diol.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)butane-2,3-diol |
|---|---|
| PubChem CID | 103452745 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)butane-2,3-diol |
| SMILES | CC(O)C(O)CC1CCOc2ccccc21 |
| InChI | InChI=1S/C13H18O3/c1-9(14)12(15)8-10-6-7-16-13-5-3-2-4-11(10)13/h2-5,9-10,12,14-15H,6-8H2,1H3 |
| InChIKey | LKSONTRGGIUDCF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |