C17H19NO2 — CID 106695578
1-(4-aminophenyl)-2-(3,4-dihydro-2H-chromen-4-yl)ethanol (PubChem CID 106695578) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-(3,4-dihydro-2H-chromen-4-yl)ethanol.
| Compound Name | 1-(4-aminophenyl)-2-(3,4-dihydro-2H-chromen-4-yl)ethanol |
|---|---|
| PubChem CID | 106695578 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-(4-aminophenyl)-2-(3,4-dihydro-2H-chromen-4-yl)ethanol |
| SMILES | Nc1ccc(C(O)CC2CCOc3ccccc32)cc1 |
| InChI | InChI=1S/C17H19NO2/c18-14-7-5-12(6-8-14)16(19)11-13-9-10-20-17-4-2-1-3-15(13)17/h1-8,13,16,19H,9-11,18H2 |
| InChIKey | AOYDOVGISPZIAY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|