C17H20O3 — CID 104769214
2-(3,4-dihydro-2H-chromen-4-yl)-1-(5-ethylfuran-2-yl)ethanol (PubChem CID 104769214) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-4-yl)-1-(5-ethylfuran-2-yl)ethanol.
| Compound Name | 2-(3,4-dihydro-2H-chromen-4-yl)-1-(5-ethylfuran-2-yl)ethanol |
|---|---|
| PubChem CID | 104769214 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-4-yl)-1-(5-ethylfuran-2-yl)ethanol |
| SMILES | CCc1ccc(C(O)CC2CCOc3ccccc32)o1 |
| InChI | InChI=1S/C17H20O3/c1-2-13-7-8-17(20-13)15(18)11-12-9-10-19-16-6-4-3-5-14(12)16/h3-8,12,15,18H,2,9-11H2,1H3 |
| InChIKey | OSTGMDDYXFJBQN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |