C16H16O3 — CID 63710274
3,4-dihydro-2H-chromen-4-yl-(5-ethylfuran-2-yl)methanone (PubChem CID 63710274) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-4-yl-(5-ethylfuran-2-yl)methanone.
| Compound Name | 3,4-dihydro-2H-chromen-4-yl-(5-ethylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 63710274 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3,4-dihydro-2H-chromen-4-yl-(5-ethylfuran-2-yl)methanone |
| SMILES | CCc1ccc(C(=O)C2CCOc3ccccc32)o1 |
| InChI | InChI=1S/C16H16O3/c1-2-11-7-8-15(19-11)16(17)13-9-10-18-14-6-4-3-5-12(13)14/h3-8,13H,2,9-10H2,1H3 |
| InChIKey | KYZVWGIVKDBQSS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |