C16H24O4 — CID 104770040
3-(3,4-dihydro-2H-chromen-4-yl)-1,1-diethoxypropan-2-ol (PubChem CID 104770040) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-4-yl)-1,1-diethoxypropan-2-ol.
| Compound Name | 3-(3,4-dihydro-2H-chromen-4-yl)-1,1-diethoxypropan-2-ol |
|---|---|
| PubChem CID | 104770040 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-4-yl)-1,1-diethoxypropan-2-ol |
| SMILES | CCOC(OCC)C(O)CC1CCOc2ccccc21 |
| InChI | InChI=1S/C16H24O4/c1-3-18-16(19-4-2)14(17)11-12-9-10-20-15-8-6-5-7-13(12)15/h5-8,12,14,16-17H,3-4,9-11H2,1-2H3 |
| InChIKey | XXVKDWFIWFPMOO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|