C18H26O3 — CID 116747190
1-(3,4-dihydro-2H-chromen-4-yl)-3-ethoxy-3-ethylpentan-2-one (PubChem CID 116747190) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-3-ethoxy-3-ethylpentan-2-one.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-ethoxy-3-ethylpentan-2-one |
|---|---|
| PubChem CID | 116747190 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-3-ethoxy-3-ethylpentan-2-one |
| SMILES | CCOC(CC)(CC)C(=O)CC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H26O3/c1-4-18(5-2,21-6-3)17(19)13-14-11-12-20-16-10-8-7-9-15(14)16/h7-10,14H,4-6,11-13H2,1-3H3 |
| InChIKey | ATPCNUBMRGMCPY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |