C30H46O3 — CID 144561195
4-[1-[4-(3,3-dimethylbutan-2-yl)phenoxy]-3,3-dimethylbutoxy]-3,4-dihydro-2H-chromene;propane (PubChem CID 144561195) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is 4-[1-[4-(3,3-dimethylbutan-2-yl)phenoxy]-3,3-dimethylbutoxy]-3,4-dihydro-2H-chromene;propane.
| Compound Name | 4-[1-[4-(3,3-dimethylbutan-2-yl)phenoxy]-3,3-dimethylbutoxy]-3,4-dihydro-2H-chromene;propane |
|---|---|
| PubChem CID | 144561195 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 4-[1-[4-(3,3-dimethylbutan-2-yl)phenoxy]-3,3-dimethylbutoxy]-3,4-dihydro-2H-chromene;propane |
| SMILES | CC(c1ccc(OC(CC(C)(C)C)OC2CCOc3ccccc32)cc1)C(C)(C)C.CCC |
| InChI | InChI=1S/C27H38O3.C3H8/c1-19(27(5,6)7)20-12-14-21(15-13-20)29-25(18-26(2,3)4)30-24-16-17-28-23-11-9-8-10-22(23)24;1-3-2/h8-15,19,24-25H,16-18H2,1-7H3;3H2,1-2H3 |
| InChIKey | MHEJCHGEZUCDJI-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|