C25H24O5 — CID 54558409
ethyl 2-[4-(3,4-dihydro-2H-chromen-4-yl)phenoxy]-2-phenoxyacetate (PubChem CID 54558409) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is ethyl 2-[4-(3,4-dihydro-2H-chromen-4-yl)phenoxy]-2-phenoxyacetate.
| Compound Name | ethyl 2-[4-(3,4-dihydro-2H-chromen-4-yl)phenoxy]-2-phenoxyacetate |
|---|---|
| PubChem CID | 54558409 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | ethyl 2-[4-(3,4-dihydro-2H-chromen-4-yl)phenoxy]-2-phenoxyacetate |
| SMILES | CCOC(=O)C(Oc1ccccc1)Oc1ccc(C2CCOc3ccccc32)cc1 |
| InChI | InChI=1S/C25H24O5/c1-2-27-24(26)25(29-19-8-4-3-5-9-19)30-20-14-12-18(13-15-20)21-16-17-28-23-11-7-6-10-22(21)23/h3-15,21,25H,2,16-17H2,1H3 |
| InChIKey | ZOUYRUTYTRMJTP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|