C16H22N2O3 — CID 110400066
ethyl 4-(3,4-dihydro-2H-chromen-4-yl)piperazine-1-carboxylate (PubChem CID 110400066) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl 4-(3,4-dihydro-2H-chromen-4-yl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(3,4-dihydro-2H-chromen-4-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110400066 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | ethyl 4-(3,4-dihydro-2H-chromen-4-yl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C2CCOc3ccccc32)CC1 |
| InChI | InChI=1S/C16H22N2O3/c1-2-20-16(19)18-10-8-17(9-11-18)14-7-12-21-15-6-4-3-5-13(14)15/h3-6,14H,2,7-12H2,1H3 |
| InChIKey | AJBWWXOMGICULG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |